CAS 2567495-07-0 is the registry number for 2,2-Difluoro-2,3,4,5-tetrahydrobenzo(f)(1,4)oxazepine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
2,2-difluoro-4,5-dihydro-3H-1,4-benzoxazepine;hydrochloride (CAS 2567495-07-0) is a chemical compound with the molecular formula C9H10ClF2NO and a molecular weight of 221.63 g/mol. IUPAC name: 2,2-difluoro-4,5-dihydro-3H-1,4-benzoxazepine;hydrochloride. InChIKey: LUVZNYZMHHWXRD-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2NO |
|---|---|
| Molecular weight | 221.63 g/mol |
| IUPAC name | 2,2-difluoro-4,5-dihydro-3H-1,4-benzoxazepine;hydrochloride |
| InChIKey | LUVZNYZMHHWXRD-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2OC(CN1)(F)F.Cl |
Computed by PubChem (NCBI)