CAS 2158836-75-8 is the registry number for 4-Chloro-2-(2,2-difluoro-propoxy)-phenylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-chloro-2-(2,2-difluoropropoxy)aniline (CAS 2158836-75-8) is a chemical compound with the molecular formula C9H10ClF2NO and a molecular weight of 221.63 g/mol. IUPAC name: 4-chloro-2-(2,2-difluoropropoxy)aniline. InChIKey: HHPOSUHNOOUUHC-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2NO |
|---|---|
| Molecular weight | 221.63 g/mol |
| IUPAC name | 4-chloro-2-(2,2-difluoropropoxy)aniline |
| InChIKey | HHPOSUHNOOUUHC-UHFFFAOYSA-N |
| SMILES | CC(COC1=C(C=CC(=C1)Cl)N)(F)F |
Computed by PubChem (NCBI)