CAS 1208090-93-0 appears in our catalog under these names: 1-(3,4-Dichlorophenyl)-2,2-dihydroxyethan-1-one, 95%, 1-(3,4-Dichlorophenyl)-2,2-dihydroxyethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
1-(3,4-dichlorophenyl)-2,2-dihydroxyethanone (CAS 1208090-93-0) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-2,2-dihydroxyethanone. InChIKey: DCRUOXMDORXCDB-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-2,2-dihydroxyethanone |
| InChIKey | DCRUOXMDORXCDB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)C(O)O)Cl)Cl |
Computed by PubChem (NCBI)