CAS 1210830-60-6 appears in our catalog under these names: N-Fmoc-(r)-2-(methylamino)butyric acid, 95%, (R)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)(methyl)amino)butanoic acid, Fmoc-N-Me-D-Abu-OH 98%, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)butanoic acid, 98%, 98%, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)butanoic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 2.5g.
(2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoic acid (CAS 1210830-60-6) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: (2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoic acid. InChIKey: WBNLTUKBCCEZSD-GOSISDBHSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | (2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoic acid |
| InChIKey | WBNLTUKBCCEZSD-GOSISDBHSA-N |
| SMILES | CC[C@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)