CAS 1310575-53-1 appears in our catalog under these names: Fmoc-n-methyl-l-2-aminobutyric acid, 98%, Fmoc–N–Me–Abu–OH, Fmoc-N-methyl-L-2-aminobutyric acid, Fmoc-N-Me-Abu-OH 95%, (2S)-2-[[(9H-Fluoren-9-ylmethoxy)carbonyl](methyl)amino]butanoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 50g, 100mg, 500g, 100g.
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoic acid (CAS 1310575-53-1) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoic acid. InChIKey: WBNLTUKBCCEZSD-SFHVURJKSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoic acid |
| InChIKey | WBNLTUKBCCEZSD-SFHVURJKSA-N |
| SMILES | CC[C@@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)