Products 1211535-62-4
CAS 1211535-62-4 appears in our catalog under these names: 6-(Difluoromethoxy)nicotinic acid, 95%, 6–(Difluoromethoxy)nicotinic acid, 6-(Difluoromethoxy)nicotinic acid, 6-(Difluoromethoxy)nicotinic acid, 95%, 95%, 6-(Difluoromethoxy)nicotinic acid, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 500mg.
6-(difluoromethoxy)pyridine-3-carboxylic acid (CAS 1211535-62-4) is a chemical compound with the molecular formula C7H5F2NO3 and a molecular weight of 189.12 g/mol. IUPAC name: 6-(difluoromethoxy)pyridine-3-carboxylic acid. InChIKey: CEXGVODHXUFPML-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO3 |
|---|---|
| Molecular weight | 189.12 g/mol |
| IUPAC name | 6-(difluoromethoxy)pyridine-3-carboxylic acid |
| InChIKey | CEXGVODHXUFPML-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)O)OC(F)F |
Computed by PubChem (NCBI)