Products 1211541-06-8
CAS 1211541-06-8 is the registry number for 5-Bromo-6-(trifluoromethyl)pyridine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-bromo-6-(trifluoromethyl)pyridine-2-carboxylic acid (CAS 1211541-06-8) is a chemical compound with the molecular formula C7H3BrF3NO2 and a molecular weight of 270.00 g/mol. IUPAC name: 5-bromo-6-(trifluoromethyl)pyridine-2-carboxylic acid. InChIKey: WSNHVRGSOXQQTO-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3NO2 |
|---|---|
| Molecular weight | 270.00 g/mol |
| IUPAC name | 5-bromo-6-(trifluoromethyl)pyridine-2-carboxylic acid |
| InChIKey | WSNHVRGSOXQQTO-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Br)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)