CAS 1211578-87-8 is the registry number for 6-(Trifluoromethyl)-1H-pyrazolo(3,4-b)pyridin-3-amine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
6-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-amine (CAS 1211578-87-8) is a chemical compound with the molecular formula C7H5F3N4 and a molecular weight of 202.14 g/mol. IUPAC name: 6-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-amine. InChIKey: OHVUCFMMMBIQOT-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N4 |
|---|---|
| Molecular weight | 202.14 g/mol |
| IUPAC name | 6-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-amine |
| InChIKey | OHVUCFMMMBIQOT-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=NNC(=C21)N)C(F)(F)F |
Computed by PubChem (NCBI)