CAS 121247-16-3 is the registry number for 1–(2,3–DIFLUORO–6–NITROPHENYL)PROPAN–2–ONE. Offered by: GLPBio. Available pack sizes: 1g.
1-(2,3-difluoro-6-nitrophenyl)propan-2-one (CAS 121247-16-3) is a chemical compound with the molecular formula C9H7F2NO3 and a molecular weight of 215.15 g/mol. IUPAC name: 1-(2,3-difluoro-6-nitrophenyl)propan-2-one. InChIKey: ICTSDDZTPXZWEM-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO3 |
|---|---|
| Molecular weight | 215.15 g/mol |
| IUPAC name | 1-(2,3-difluoro-6-nitrophenyl)propan-2-one |
| InChIKey | ICTSDDZTPXZWEM-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=C(C=CC(=C1F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)