CAS 66648-38-2 appears in our catalog under these names: 2-(2,6-Difluorobenzamido)acetic acid, 97%, 2-((2,6-Difluorophenyl)formamido)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-[(2,6-difluorobenzoyl)amino]acetic acid (CAS 66648-38-2) is a chemical compound with the molecular formula C9H7F2NO3 and a molecular weight of 215.15 g/mol. IUPAC name: 2-[(2,6-difluorobenzoyl)amino]acetic acid. InChIKey: GKFLIRAXEAGJGO-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO3 |
|---|---|
| Molecular weight | 215.15 g/mol |
| IUPAC name | 2-[(2,6-difluorobenzoyl)amino]acetic acid |
| InChIKey | GKFLIRAXEAGJGO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)NCC(=O)O)F |
Computed by PubChem (NCBI)