CAS 1248263-78-6 is the registry number for 2-(((2,4-Difluorophenyl)methyl)amino)-2-oxo-acetic acid. Offered by: TRC. Available pack sizes: 250mg.
2-[(2,4-difluorophenyl)methylamino]-2-oxoacetic acid (CAS 1248263-78-6) is a chemical compound with the molecular formula C9H7F2NO3 and a molecular weight of 215.15 g/mol. IUPAC name: 2-[(2,4-difluorophenyl)methylamino]-2-oxoacetic acid. InChIKey: YQDORBOSJQHAGW-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO3 |
|---|---|
| Molecular weight | 215.15 g/mol |
| IUPAC name | 2-[(2,4-difluorophenyl)methylamino]-2-oxoacetic acid |
| InChIKey | YQDORBOSJQHAGW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)CNC(=O)C(=O)O |
Computed by PubChem (NCBI)