CAS 1909319-31-8 is the registry number for 3-(2,6-Difluorophenyl)-2-methyl-2-nitrooxirane. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(2,6-difluorophenyl)-2-methyl-2-nitrooxirane (CAS 1909319-31-8) is a chemical compound with the molecular formula C9H7F2NO3 and a molecular weight of 215.15 g/mol. IUPAC name: 3-(2,6-difluorophenyl)-2-methyl-2-nitrooxirane. InChIKey: FRXSMOPXPMMEAQ-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO3 |
|---|---|
| Molecular weight | 215.15 g/mol |
| IUPAC name | 3-(2,6-difluorophenyl)-2-methyl-2-nitrooxirane |
| InChIKey | FRXSMOPXPMMEAQ-UHFFFAOYSA-N |
| SMILES | CC1(C(O1)C2=C(C=CC=C2F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)