CAS 480450-76-8 is the registry number for Methyl 2-((2,4-difluorophenyl)amino)-2-oxoacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(2,4-difluoroanilino)-2-oxoacetate (CAS 480450-76-8) is a chemical compound with the molecular formula C9H7F2NO3 and a molecular weight of 215.15 g/mol. IUPAC name: methyl 2-(2,4-difluoroanilino)-2-oxoacetate. InChIKey: COIRHBDRSOTDJK-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO3 |
|---|---|
| Molecular weight | 215.15 g/mol |
| IUPAC name | methyl 2-(2,4-difluoroanilino)-2-oxoacetate |
| InChIKey | COIRHBDRSOTDJK-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)NC1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)