CAS 1345413-22-0 is the registry number for 1-(3,4-Difluorophenyl)-3-nitro-1-propanone. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
1-(3,4-difluorophenyl)-3-nitropropan-1-one (CAS 1345413-22-0) is a chemical compound with the molecular formula C9H7F2NO3 and a molecular weight of 215.15 g/mol. IUPAC name: 1-(3,4-difluorophenyl)-3-nitropropan-1-one. InChIKey: RLFBFKNBBZJWHA-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO3 |
|---|---|
| Molecular weight | 215.15 g/mol |
| IUPAC name | 1-(3,4-difluorophenyl)-3-nitropropan-1-one |
| InChIKey | RLFBFKNBBZJWHA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)CC[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)