Products 2919560-73-7

CAS 2919560-73-7 is the registry number for 4-(2,2-Difluoropropanoyl)picolinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(2,2-difluoropropanoyl)pyridine-2-carboxylic acid (CAS 2919560-73-7) is a chemical compound with the molecular formula C9H7F2NO3 and a molecular weight of 215.15 g/mol. IUPAC name: 4-(2,2-difluoropropanoyl)pyridine-2-carboxylic acid. InChIKey: WMCZXQMRYORDLH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7F2NO3
Molecular weight215.15 g/mol
IUPAC name4-(2,2-difluoropropanoyl)pyridine-2-carboxylic acid
InChIKeyWMCZXQMRYORDLH-UHFFFAOYSA-N
SMILESCC(C(=O)C1=CC(=NC=C1)C(=O)O)(F)F

Computed by PubChem (NCBI)