CAS 2919560-73-7 is the registry number for 4-(2,2-Difluoropropanoyl)picolinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2,2-difluoropropanoyl)pyridine-2-carboxylic acid (CAS 2919560-73-7) is a chemical compound with the molecular formula C9H7F2NO3 and a molecular weight of 215.15 g/mol. IUPAC name: 4-(2,2-difluoropropanoyl)pyridine-2-carboxylic acid. InChIKey: WMCZXQMRYORDLH-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO3 |
|---|---|
| Molecular weight | 215.15 g/mol |
| IUPAC name | 4-(2,2-difluoropropanoyl)pyridine-2-carboxylic acid |
| InChIKey | WMCZXQMRYORDLH-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC(=NC=C1)C(=O)O)(F)F |
Computed by PubChem (NCBI)