Products 923691-92-3
CAS 923691-92-3 appears in our catalog under these names: 2-((3,5-Difluorophenyl)formamido)acetic acid, 95%, 2-((3,5-Difluorophenyl)formamido)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-[(3,5-difluorobenzoyl)amino]acetic acid (CAS 923691-92-3) is a chemical compound with the molecular formula C9H7F2NO3 and a molecular weight of 215.15 g/mol. IUPAC name: 2-[(3,5-difluorobenzoyl)amino]acetic acid. InChIKey: CRKGNCMDWYCYOJ-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO3 |
|---|---|
| Molecular weight | 215.15 g/mol |
| IUPAC name | 2-[(3,5-difluorobenzoyl)amino]acetic acid |
| InChIKey | CRKGNCMDWYCYOJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)