CAS 1213630-93-3 appears in our catalog under these names: (R)-1-[3-(Trifluoromethyl)phenyl]ethylaminehydrochloride, 95%, (R)-1-(3-(Trifluoromethyl)phenyl)ethanamine hydrochloride, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 2.5g, 10g, 5g.
(1R)-1-[3-(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 1213630-93-3) is a chemical compound with the molecular formula C9H11ClF3N and a molecular weight of 225.64 g/mol. IUPAC name: (1R)-1-[3-(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: XJVAGOCFOAYRDT-FYZOBXCZSA-N.
| Molecular formula | C9H11ClF3N |
|---|---|
| Molecular weight | 225.64 g/mol |
| IUPAC name | (1R)-1-[3-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | XJVAGOCFOAYRDT-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=CC(=CC=C1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)