CAS 1213917-78-2 is the registry number for (S)-2-Amino-2-(3,5-dichlorophenyl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-2-(3,5-dichlorophenyl)acetic acid (CAS 1213917-78-2) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: (2S)-2-amino-2-(3,5-dichlorophenyl)acetic acid. InChIKey: GAQVGSJHXPYMCP-ZETCQYMHSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | (2S)-2-amino-2-(3,5-dichlorophenyl)acetic acid |
| InChIKey | GAQVGSJHXPYMCP-ZETCQYMHSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)