Products 1214350-42-1
CAS 1214350-42-1 is the registry number for 4-Bromo-1-(chloromethyl)-2-(trifluoromethyl)benzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-bromo-1-(chloromethyl)-2-(trifluoromethyl)benzene (CAS 1214350-42-1) is a chemical compound with the molecular formula C8H5BrClF3 and a molecular weight of 273.48 g/mol. IUPAC name: 4-bromo-1-(chloromethyl)-2-(trifluoromethyl)benzene. InChIKey: XVCNGLMYDHVHNO-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3 |
|---|---|
| Molecular weight | 273.48 g/mol |
| IUPAC name | 4-bromo-1-(chloromethyl)-2-(trifluoromethyl)benzene |
| InChIKey | XVCNGLMYDHVHNO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(F)(F)F)CCl |
Computed by PubChem (NCBI)