Products 1214366-92-3
CAS 1214366-92-3 is the registry number for Ethyl 5,6-Dichloropicolinate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
Ethyl 5,6-dichloropyridine-2-carboxylate (CAS 1214366-92-3) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: ethyl 5,6-dichloropyridine-2-carboxylate. InChIKey: ZNKCKBUCUHCEGP-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | ethyl 5,6-dichloropyridine-2-carboxylate |
| InChIKey | ZNKCKBUCUHCEGP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)