Products 1214369-42-2
CAS 1214369-42-2 appears in our catalog under these names: 2-Cyano-4-fluorobenzoic acid, 2-Cyano-4-fluorobenzoic acid 98%, 2-Cyano-4-fluorobenzoic acid, 97%, 2-Cyano-4-fluorobenzoic acid, 97%, 97%. Offered by: Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 2,5g, 250mg, 1g, 5g, 100mg.
2-cyano-4-fluorobenzoic acid (CAS 1214369-42-2) is a chemical compound with the molecular formula C8H4FNO2 and a molecular weight of 165.12 g/mol. IUPAC name: 2-cyano-4-fluorobenzoic acid. InChIKey: SVBQRUGIKCKEQZ-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2 |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | 2-cyano-4-fluorobenzoic acid |
| InChIKey | SVBQRUGIKCKEQZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C#N)C(=O)O |
Computed by PubChem (NCBI)