Products 1216074-15-5
CAS 1216074-15-5 is the registry number for 5-HT2CR agonist 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-chlorospiro[chromene-2,4'-piperidine] (CAS 1216074-15-5) is a chemical compound with the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. IUPAC name: 7-chlorospiro[chromene-2,4'-piperidine]. InChIKey: OSLHZPLWTXHOAZ-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | 7-chlorospiro[chromene-2,4'-piperidine] |
| InChIKey | OSLHZPLWTXHOAZ-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C=CC3=C(O2)C=C(C=C3)Cl |
Computed by PubChem (NCBI)
Synonyms:
5-HT2CR agonist 1, orb2567180