CAS 1217602-18-0 is the registry number for (2S,4S)-2-Amino-4-butylpentanedioic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(2S,4S)-2-amino-4-butylpentanedioic acid (CAS 1217602-18-0) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: (2S,4S)-2-amino-4-butylpentanedioic acid. InChIKey: IMGQZBSGZRAKSV-BQBZGAKWSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (2S,4S)-2-amino-4-butylpentanedioic acid |
| InChIKey | IMGQZBSGZRAKSV-BQBZGAKWSA-N |
| SMILES | CCCC[C@@H](C[C@@H](C(=O)O)N)C(=O)O |
Computed by PubChem (NCBI)