CAS 1784008-19-0 is the registry number for 1-tert-Butyl 4-Methyl 3-Hydroxypiperidine-1,4-dicarboxylate. Offered by: TRC. Available pack sizes: 2,5g.
(2R,4R)-2-amino-4-butylpentanedioic acid (CAS 1784008-19-0) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: (2R,4R)-2-amino-4-butylpentanedioic acid. InChIKey: IMGQZBSGZRAKSV-RNFRBKRXSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (2R,4R)-2-amino-4-butylpentanedioic acid |
| InChIKey | IMGQZBSGZRAKSV-RNFRBKRXSA-N |
| SMILES | CCCC[C@H](C[C@H](C(=O)O)N)C(=O)O |
Computed by PubChem (NCBI)