Products 1221726-30-2
CAS 1221726-30-2 is the registry number for (8-Bromo-2,3-dihydro-1,4-benzodioxin-6-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methanamine;hydrochloride (CAS 1221726-30-2) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: (5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methanamine;hydrochloride. InChIKey: NDAXWEGBKKQPGV-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClNO2 |
|---|---|
| Molecular weight | 280.54 g/mol |
| IUPAC name | (5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methanamine;hydrochloride |
| InChIKey | NDAXWEGBKKQPGV-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C=C2Br)CN.Cl |
Computed by PubChem (NCBI)