Products 1222184-72-6

CAS 1222184-72-6 is the registry number for 3-Aminopyridine-2,4-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 1000mg, 500mg.

Structural formula: {0} (CAS {1})

3-aminopyridine-2,4-dicarboxylic acid (CAS 1222184-72-6) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 3-aminopyridine-2,4-dicarboxylic acid. InChIKey: XUESBDUVQIELIK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6N2O4
Molecular weight182.13 g/mol
IUPAC name3-aminopyridine-2,4-dicarboxylic acid
InChIKeyXUESBDUVQIELIK-UHFFFAOYSA-N
SMILESC1=CN=C(C(=C1C(=O)O)N)C(=O)O

Computed by PubChem (NCBI)