Products 122224-58-2

CAS 122224-58-2 is the registry number for 6,7-Dichloro-1,4-dihydro-4-oxo-3-quinolinecarboxylic Acid Ethyl Ester. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 2,5g, 500mg, 5000mg.

Structural formula: {0} (CAS {1})

Ethyl 6,7-dichloro-4-oxo-1H-quinoline-3-carboxylate (CAS 122224-58-2) is a chemical compound with the molecular formula C12H9Cl2NO3 and a molecular weight of 286.11 g/mol. IUPAC name: ethyl 6,7-dichloro-4-oxo-1H-quinoline-3-carboxylate. InChIKey: PMGNGTDFPXCYNP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9Cl2NO3
Molecular weight286.11 g/mol
IUPAC nameethyl 6,7-dichloro-4-oxo-1H-quinoline-3-carboxylate
InChIKeyPMGNGTDFPXCYNP-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CNC2=CC(=C(C=C2C1=O)Cl)Cl

Computed by PubChem (NCBI)