CAS 122520-79-0 appears in our catalog under these names: Tyrphostin AG30, 98%, Tyrphostin AG30/ 98%, Tyrphostin AG30, Tyrphostin AG30 99%, (E)-2-Cyano-3-(3,4-dihydroxyphenyl)acrylic acid, 99%, 99%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5g, 2mg, 5mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
(E)-2-cyano-3-(3,4-dihydroxyphenyl)prop-2-enoic acid (CAS 122520-79-0) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: (E)-2-cyano-3-(3,4-dihydroxyphenyl)prop-2-enoic acid. InChIKey: CJMWBHLWSMKFSM-XVNBXDOJSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | (E)-2-cyano-3-(3,4-dihydroxyphenyl)prop-2-enoic acid |
| InChIKey | CJMWBHLWSMKFSM-XVNBXDOJSA-N |
| SMILES | C1=CC(=C(C=C1/C=C(\C#N)/C(=O)O)O)O |
Computed by PubChem (NCBI)