Products 1226060-19-0
CAS 1226060-19-0 appears in our catalog under these names: 5-(3-Methoxyphenyl)picolinic acid, 95+%, 95+%, 5-(3-Methoxyphenyl)picolinic acid, 95+%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-(3-methoxyphenyl)pyridine-2-carboxylic acid (CAS 1226060-19-0) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 5-(3-methoxyphenyl)pyridine-2-carboxylic acid. InChIKey: VILSJHFLUCEYCY-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 5-(3-methoxyphenyl)pyridine-2-carboxylic acid |
| InChIKey | VILSJHFLUCEYCY-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CN=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)