CAS 122745-09-9 appears in our catalog under these names: (R)–2–Amino–3–(naphthalen–1–yl)propanoic acid hydrochloride, 3-(1-Naphthyl)-D-alanine Hydrochloride, >98.0%(T), 3-(1-Naphthyl)-D-alanine Hydrochloride, 3-(1-Naphthyl)-D-alanine.HCl, 95%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 200mg, 250mg.
(2R)-2-amino-3-naphthalen-1-ylpropanoic acid;hydrochloride (CAS 122745-09-9) is a chemical compound with the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. IUPAC name: (2R)-2-amino-3-naphthalen-1-ylpropanoic acid;hydrochloride. InChIKey: BKQQPCDQZZTLSE-UTONKHPSSA-N.
| Molecular formula | C13H14ClNO2 |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | (2R)-2-amino-3-naphthalen-1-ylpropanoic acid;hydrochloride |
| InChIKey | BKQQPCDQZZTLSE-UTONKHPSSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)