CAS 122745-11-3 appears in our catalog under these names: 3-(2-Naphthyl)-D-alanine.HCl, 95%, (R)–2–Amino–3–(naphthalen–2–yl)propanoic acid hydrochloride, (R)-2-Amino-3-(naphthalen-2-yl)propanoic acid hydrochloride, 98%, 98%. Offered by: Fluorochem, GLPBio, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 100mg.
(2R)-2-amino-3-naphthalen-2-ylpropanoic acid;hydrochloride (CAS 122745-11-3) is a chemical compound with the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. IUPAC name: (2R)-2-amino-3-naphthalen-2-ylpropanoic acid;hydrochloride. InChIKey: QXEYSNIVQNSZGX-UTONKHPSSA-N.
| Molecular formula | C13H14ClNO2 |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | (2R)-2-amino-3-naphthalen-2-ylpropanoic acid;hydrochloride |
| InChIKey | QXEYSNIVQNSZGX-UTONKHPSSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)