Products 122970-27-8
CAS 122970-27-8 appears in our catalog under these names: 2-Vinyl-adenosine (2-VA), min. 98%, 10 mg, plastic, 2-Vinyl-adenosine (2-VA), min. 98%, 50 mg, plastic. Offered by: Roth. Available pack sizes: 10mg, 50mg.
(2R,3R,4S,5R)-2-(6-amino-2-ethenylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 122970-27-8) is a chemical compound with the molecular formula C12H15N5O4 and a molecular weight of 293.28 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(6-amino-2-ethenylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: BEZMXCVIYMKUKU-JJNLEZRASA-N.
| Molecular formula | C12H15N5O4 |
|---|---|
| Molecular weight | 293.28 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(6-amino-2-ethenylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | BEZMXCVIYMKUKU-JJNLEZRASA-N |
| SMILES | C=CC1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N |
Computed by PubChem (NCBI)