Products 1443367-96-1
CAS 1443367-96-1 appears in our catalog under these names: N6–Acetyl–2'–deoxyadenosine, N6-Acetyl-2'-deoxyadenosine. Offered by: GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 25mg, 10g, 5g, 25g, 250mg.
N-[9-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]acetamide (CAS 1443367-96-1) is a chemical compound with the molecular formula C12H15N5O4 and a molecular weight of 293.28 g/mol. IUPAC name: N-[9-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]acetamide. InChIKey: DKVIBEFOBOVION-UHFFFAOYSA-N.
| Molecular formula | C12H15N5O4 |
|---|---|
| Molecular weight | 293.28 g/mol |
| IUPAC name | N-[9-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]acetamide |
| InChIKey | DKVIBEFOBOVION-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C2C(=NC=N1)N(C=N2)C3CC(C(O3)CO)O |
Computed by PubChem (NCBI)