Products 2204369-23-1
CAS 2204369-23-1 appears in our catalog under these names: Entecavir Impurity 17（Entecavir EP Impurity C）, 8-Hydroxy Entecavir. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-amino-9-[(1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1,7-dihydropurine-6,8-dione (CAS 2204369-23-1) is a chemical compound with the molecular formula C12H15N5O4 and a molecular weight of 293.28 g/mol. IUPAC name: 2-amino-9-[(1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1,7-dihydropurine-6,8-dione. InChIKey: LSIYUWXAEQDWBD-ACZMJKKPSA-N.
| Molecular formula | C12H15N5O4 |
|---|---|
| Molecular weight | 293.28 g/mol |
| IUPAC name | 2-amino-9-[(1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1,7-dihydropurine-6,8-dione |
| InChIKey | LSIYUWXAEQDWBD-ACZMJKKPSA-N |
| SMILES | C=C1[C@H](C[C@@H]([C@H]1CO)O)N2C3=C(C(=O)NC(=N3)N)NC2=O |
Computed by PubChem (NCBI)