CAS 29031-25-2 is the registry number for Eritadenine Acetonide. Offered by: TRC. Available pack sizes: 100mg.
(4R,5R)-5-[(6-aminopurin-9-yl)methyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid (CAS 29031-25-2) is a chemical compound with the molecular formula C12H15N5O4 and a molecular weight of 293.28 g/mol. IUPAC name: (4R,5R)-5-[(6-aminopurin-9-yl)methyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid. InChIKey: IFMFIUACUSZASY-HTRCEHHLSA-N.
| Molecular formula | C12H15N5O4 |
|---|---|
| Molecular weight | 293.28 g/mol |
| IUPAC name | (4R,5R)-5-[(6-aminopurin-9-yl)methyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
| InChIKey | IFMFIUACUSZASY-HTRCEHHLSA-N |
| SMILES | CC1(O[C@@H]([C@@H](O1)C(=O)O)CN2C=NC3=C(N=CN=C32)N)C |
Computed by PubChem (NCBI)