Products 6612-73-3
CAS 6612-73-3 appears in our catalog under these names: 3'-O-Acetyl-2'-deoxyadenosine, 3′-O-Acetyl-2′-deoxyadenosine, 98%, 98%, 3′-O-Acetyl-2′-deoxyadenosine, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 25mg, 100mg, 500mg, 250mg, 1g.
[(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] acetate (CAS 6612-73-3) is a chemical compound with the molecular formula C12H15N5O4 and a molecular weight of 293.28 g/mol. IUPAC name: [(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] acetate. InChIKey: ORNWXPWLGGXUNT-DJLDLDEBSA-N.
| Molecular formula | C12H15N5O4 |
|---|---|
| Molecular weight | 293.28 g/mol |
| IUPAC name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] acetate |
| InChIKey | ORNWXPWLGGXUNT-DJLDLDEBSA-N |
| SMILES | CC(=O)O[C@H]1C[C@@H](O[C@@H]1CO)N2C=NC3=C(N=CN=C32)N |
Computed by PubChem (NCBI)