Products 1795791-10-4
CAS 1795791-10-4 is the registry number for Entecavir Impurity 119. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-9-[(1S,3R)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1,7-dihydropurine-6,8-dione (CAS 1795791-10-4) is a chemical compound with the molecular formula C12H15N5O4 and a molecular weight of 293.28 g/mol. IUPAC name: 2-amino-9-[(1S,3R)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1,7-dihydropurine-6,8-dione. InChIKey: LSIYUWXAEQDWBD-WABBHOIFSA-N.
| Molecular formula | C12H15N5O4 |
|---|---|
| Molecular weight | 293.28 g/mol |
| IUPAC name | 2-amino-9-[(1S,3R)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1,7-dihydropurine-6,8-dione |
| InChIKey | LSIYUWXAEQDWBD-WABBHOIFSA-N |
| SMILES | C=C1[C@H](CC([C@H]1CO)O)N2C3=C(C(=O)NC(=N3)N)NC2=O |
Computed by PubChem (NCBI)
Synonyms:
Entecavir Impurity 119