CAS 186046-99-1 appears in our catalog under these names: N6-Boc-adenosin-9-yl acetic acid, N6-Boc-adenosin-9-yl acetic acid 97%, (N6-Boc-N9-adeninyl)acetic acid, 98%, 98%, 2-(6-((tert-Butoxycarbonyl)amino)-9H-purin-9-yl)acetic acid, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 500mg, 1000mg, 2000mg, 5000mg, 10g, 250mg, 1g, 5g.
2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]purin-9-yl]acetic acid (CAS 186046-99-1) is a chemical compound with the molecular formula C12H15N5O4 and a molecular weight of 293.28 g/mol. IUPAC name: 2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]purin-9-yl]acetic acid. InChIKey: BQWXVHALCKHHGO-UHFFFAOYSA-N.
| Molecular formula | C12H15N5O4 |
|---|---|
| Molecular weight | 293.28 g/mol |
| IUPAC name | 2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]purin-9-yl]acetic acid |
| InChIKey | BQWXVHALCKHHGO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C2C(=NC=N1)N(C=N2)CC(=O)O |
Computed by PubChem (NCBI)