CAS 65427-77-2 is the registry number for 2-[4-(4-Nitro-2,1,3-benzoxadiazol-5-yl)piperazin-1-yl]ethanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-[4-(4-nitro-2,1,3-benzoxadiazol-5-yl)piperazin-1-yl]ethanol (CAS 65427-77-2) is a chemical compound with the molecular formula C12H15N5O4 and a molecular weight of 293.28 g/mol. IUPAC name: 2-[4-(4-nitro-2,1,3-benzoxadiazol-5-yl)piperazin-1-yl]ethanol. InChIKey: FTUJMLRZRUABPN-UHFFFAOYSA-N.
| Molecular formula | C12H15N5O4 |
|---|---|
| Molecular weight | 293.28 g/mol |
| IUPAC name | 2-[4-(4-nitro-2,1,3-benzoxadiazol-5-yl)piperazin-1-yl]ethanol |
| InChIKey | FTUJMLRZRUABPN-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCO)C2=C(C3=NON=C3C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)