Products 1236217-50-7
CAS 1236217-50-7 is the registry number for 2-Fluoro-6-(trifluoromethoxy)benzonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 0,25g, 1g, 2g, 5g.
2-fluoro-6-(trifluoromethoxy)benzonitrile (CAS 1236217-50-7) is a chemical compound with the molecular formula C8H3F4NO and a molecular weight of 205.11 g/mol. IUPAC name: 2-fluoro-6-(trifluoromethoxy)benzonitrile. InChIKey: DBEVPZOCVMDKRP-UHFFFAOYSA-N.
| Molecular formula | C8H3F4NO |
|---|---|
| Molecular weight | 205.11 g/mol |
| IUPAC name | 2-fluoro-6-(trifluoromethoxy)benzonitrile |
| InChIKey | DBEVPZOCVMDKRP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C#N)OC(F)(F)F |
Computed by PubChem (NCBI)