Products 1239741-87-7
CAS 1239741-87-7 appears in our catalog under these names: Ethyl 4-bromo-3,5-dichlorobenzoate, 95%, Ethyl 4-bromo-3,5-dichlorobenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Ethyl 4-bromo-3,5-dichlorobenzoate (CAS 1239741-87-7) is a chemical compound with the molecular formula C9H7BrCl2O2 and a molecular weight of 297.96 g/mol. IUPAC name: ethyl 4-bromo-3,5-dichlorobenzoate. InChIKey: SOOYUBZPASBJLN-UHFFFAOYSA-N.
| Molecular formula | C9H7BrCl2O2 |
|---|---|
| Molecular weight | 297.96 g/mol |
| IUPAC name | ethyl 4-bromo-3,5-dichlorobenzoate |
| InChIKey | SOOYUBZPASBJLN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)Cl)Br)Cl |
Computed by PubChem (NCBI)