Products 2221812-26-4
CAS 2221812-26-4 is the registry number for 2-(6-Bromo-2,3-dichlorophenyl)-1,3-dioxolane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
2-(6-bromo-2,3-dichlorophenyl)-1,3-dioxolane (CAS 2221812-26-4) is a chemical compound with the molecular formula C9H7BrCl2O2 and a molecular weight of 297.96 g/mol. IUPAC name: 2-(6-bromo-2,3-dichlorophenyl)-1,3-dioxolane. InChIKey: JXNJYFCHSABVJE-UHFFFAOYSA-N.
| Molecular formula | C9H7BrCl2O2 |
|---|---|
| Molecular weight | 297.96 g/mol |
| IUPAC name | 2-(6-bromo-2,3-dichlorophenyl)-1,3-dioxolane |
| InChIKey | JXNJYFCHSABVJE-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=CC(=C2Cl)Cl)Br |
Computed by PubChem (NCBI)