CAS 2379321-46-5 appears in our catalog under these names: 2-(3-Bromo-2,5-dichlorophenyl)-1,3-dioxolane, 95%, 2-(3-Bromo-2,5-dichlorophenyl)-1,3-dioxolane, ≥95%, ≥95%, 2-(3-Bromo-2,5-dichlorophenyl)-1,3-dioxolane. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g.
2-(3-bromo-2,5-dichlorophenyl)-1,3-dioxolane (CAS 2379321-46-5) is a chemical compound with the molecular formula C9H7BrCl2O2 and a molecular weight of 297.96 g/mol. IUPAC name: 2-(3-bromo-2,5-dichlorophenyl)-1,3-dioxolane. InChIKey: WQMOMOHKCLPQLZ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrCl2O2 |
|---|---|
| Molecular weight | 297.96 g/mol |
| IUPAC name | 2-(3-bromo-2,5-dichlorophenyl)-1,3-dioxolane |
| InChIKey | WQMOMOHKCLPQLZ-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C(=CC(=C2)Cl)Br)Cl |
Computed by PubChem (NCBI)