CAS 683274-78-4 is the registry number for 2-Bromo-1-(3,5-dichloro-2-methoxyphenyl)ethanone. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
2-bromo-1-(3,5-dichloro-2-methoxyphenyl)ethanone (CAS 683274-78-4) is a chemical compound with the molecular formula C9H7BrCl2O2 and a molecular weight of 297.96 g/mol. IUPAC name: 2-bromo-1-(3,5-dichloro-2-methoxyphenyl)ethanone. InChIKey: JLGKZBSXNAOYAG-UHFFFAOYSA-N.
| Molecular formula | C9H7BrCl2O2 |
|---|---|
| Molecular weight | 297.96 g/mol |
| IUPAC name | 2-bromo-1-(3,5-dichloro-2-methoxyphenyl)ethanone |
| InChIKey | JLGKZBSXNAOYAG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Cl)Cl)C(=O)CBr |
Computed by PubChem (NCBI)