Products 2221812-43-5

CAS 2221812-43-5 is the registry number for 2-(4-Bromo-2,6-dichlorophenyl)-1,3-dioxolane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(4-bromo-2,6-dichlorophenyl)-1,3-dioxolane (CAS 2221812-43-5) is a chemical compound with the molecular formula C9H7BrCl2O2 and a molecular weight of 297.96 g/mol. IUPAC name: 2-(4-bromo-2,6-dichlorophenyl)-1,3-dioxolane. InChIKey: YTXYGHCHLWOEJP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7BrCl2O2
Molecular weight297.96 g/mol
IUPAC name2-(4-bromo-2,6-dichlorophenyl)-1,3-dioxolane
InChIKeyYTXYGHCHLWOEJP-UHFFFAOYSA-N
SMILESC1COC(O1)C2=C(C=C(C=C2Cl)Br)Cl

Computed by PubChem (NCBI)