CAS 2221812-43-5 is the registry number for 2-(4-Bromo-2,6-dichlorophenyl)-1,3-dioxolane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
2-(4-bromo-2,6-dichlorophenyl)-1,3-dioxolane (CAS 2221812-43-5) is a chemical compound with the molecular formula C9H7BrCl2O2 and a molecular weight of 297.96 g/mol. IUPAC name: 2-(4-bromo-2,6-dichlorophenyl)-1,3-dioxolane. InChIKey: YTXYGHCHLWOEJP-UHFFFAOYSA-N.
| Molecular formula | C9H7BrCl2O2 |
|---|---|
| Molecular weight | 297.96 g/mol |
| IUPAC name | 2-(4-bromo-2,6-dichlorophenyl)-1,3-dioxolane |
| InChIKey | YTXYGHCHLWOEJP-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=C(C=C2Cl)Br)Cl |
Computed by PubChem (NCBI)