CAS 859212-75-2 appears in our catalog under these names: Methyl 4-(bromomethyl)-3,5-dichlorobenzoate, 95%, Methyl 4-(bromomethyl)-3,5-dichlorobenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
Methyl 4-(bromomethyl)-3,5-dichlorobenzoate (CAS 859212-75-2) is a chemical compound with the molecular formula C9H7BrCl2O2 and a molecular weight of 297.96 g/mol. IUPAC name: methyl 4-(bromomethyl)-3,5-dichlorobenzoate. InChIKey: KQHHSNCXMBIUQF-UHFFFAOYSA-N.
| Molecular formula | C9H7BrCl2O2 |
|---|---|
| Molecular weight | 297.96 g/mol |
| IUPAC name | methyl 4-(bromomethyl)-3,5-dichlorobenzoate |
| InChIKey | KQHHSNCXMBIUQF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)Cl)CBr)Cl |
Computed by PubChem (NCBI)