CAS 2092608-39-2 is the registry number for 5-Bromo-2,4-dichloro-benzeneacetic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 1g.
Methyl 2-(5-bromo-2,4-dichlorophenyl)acetate (CAS 2092608-39-2) is a chemical compound with the molecular formula C9H7BrCl2O2 and a molecular weight of 297.96 g/mol. IUPAC name: methyl 2-(5-bromo-2,4-dichlorophenyl)acetate. InChIKey: CMEVCPUNTMRXIX-UHFFFAOYSA-N.
| Molecular formula | C9H7BrCl2O2 |
|---|---|
| Molecular weight | 297.96 g/mol |
| IUPAC name | methyl 2-(5-bromo-2,4-dichlorophenyl)acetate |
| InChIKey | CMEVCPUNTMRXIX-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=C(C=C1Cl)Cl)Br |
Computed by PubChem (NCBI)