Products 2092608-39-2

CAS 2092608-39-2 is the registry number for 5-Bromo-2,4-dichloro-benzeneacetic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 2-(5-bromo-2,4-dichlorophenyl)acetate (CAS 2092608-39-2) is a chemical compound with the molecular formula C9H7BrCl2O2 and a molecular weight of 297.96 g/mol. IUPAC name: methyl 2-(5-bromo-2,4-dichlorophenyl)acetate. InChIKey: CMEVCPUNTMRXIX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7BrCl2O2
Molecular weight297.96 g/mol
IUPAC namemethyl 2-(5-bromo-2,4-dichlorophenyl)acetate
InChIKeyCMEVCPUNTMRXIX-UHFFFAOYSA-N
SMILESCOC(=O)CC1=CC(=C(C=C1Cl)Cl)Br

Computed by PubChem (NCBI)