Products 1936655-55-8
CAS 1936655-55-8 is the registry number for Methyl 4-bromomethyl-2,5-dichlorobenzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
Methyl 4-(bromomethyl)-2,5-dichlorobenzoate (CAS 1936655-55-8) is a chemical compound with the molecular formula C9H7BrCl2O2 and a molecular weight of 297.96 g/mol. IUPAC name: methyl 4-(bromomethyl)-2,5-dichlorobenzoate. InChIKey: LTDBXDINOUYZHE-UHFFFAOYSA-N.
| Molecular formula | C9H7BrCl2O2 |
|---|---|
| Molecular weight | 297.96 g/mol |
| IUPAC name | methyl 4-(bromomethyl)-2,5-dichlorobenzoate |
| InChIKey | LTDBXDINOUYZHE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C(=C1)Cl)CBr)Cl |
Computed by PubChem (NCBI)