CAS 1240528-53-3 appears in our catalog under these names: 4,5,6,7-Tetrahydro-1,3-benzothiazol-2-ylmethanamine dihydrochloride, 95%, 4,5,6,7-Tetrahydro-1,3-benzothiazol-2-ylmethanamine dihydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg.
4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethanamine;dihydrochloride (CAS 1240528-53-3) is a chemical compound with the molecular formula C8H14Cl2N2S and a molecular weight of 241.18 g/mol. IUPAC name: 4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethanamine;dihydrochloride. InChIKey: LTLFMUVSNFZYSM-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2S |
|---|---|
| Molecular weight | 241.18 g/mol |
| IUPAC name | 4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethanamine;dihydrochloride |
| InChIKey | LTLFMUVSNFZYSM-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)N=C(S2)CN.Cl.Cl |
Computed by PubChem (NCBI)