CAS 1255717-68-0 is the registry number for 2-Methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine;dihydrochloride (CAS 1255717-68-0) is a chemical compound with the molecular formula C8H14Cl2N2S and a molecular weight of 241.18 g/mol. IUPAC name: 2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine;dihydrochloride. InChIKey: YPTVADPUASOBGY-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2S |
|---|---|
| Molecular weight | 241.18 g/mol |
| IUPAC name | 2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine;dihydrochloride |
| InChIKey | YPTVADPUASOBGY-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)CCCC2N.Cl.Cl |
Computed by PubChem (NCBI)